CAS 944897-77-2

5-(4-Fluorophenyl)-1H-imidazole-2-methanamine

Description:

5-(4-Fluorophenyl)-1H-imidazole-2-methanamine, with the CAS number 944897-77-2, is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a 4-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, enhancing the compound's potential for biological activity and influencing its physicochemical properties. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can affect its solubility and reactivity. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the imidazole moiety's role in various biological processes. Additionally, the fluorine substitution may enhance metabolic stability and lipophilicity, making it a candidate for further investigation in drug design. As with many organic compounds, its stability, reactivity, and interactions with other molecules would depend on environmental conditions such as pH and temperature.

Formula: C₁₀H₁₀FN₃

InChI: InChI=1S/C10H10FN3/c11-8-3-1-7(2-4-8)9-6-13-10(5-12)14-9/h1-4,6H,5,12H2,(H,13,14)

InChI key: InChIKey=AJSVWOCYSPNHEA-UHFFFAOYSA-N

SMILES: C(N)C=1NC(=CN1)C2=CC=C(F)C=C2

Synonyms:

• 1H-Imidazole-2-methanamine, 5-(4-fluorophenyl)-
• [5-(4-Fluorophenyl)-1H-imidazol-2-yl]methanamine
• 5-(4-Fluorophenyl)-1H-imidazole-2-methanamine
• [4-(4-Fluorophenyl)-1H-imidazol-2-yl]methanamine