CAS 944897-81-8

5-(3-Chlorophenyl)-1H-imidazole-2-methanamine

Description:

5-(3-Chlorophenyl)-1H-imidazole-2-methanamine is a chemical compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of a 3-chlorophenyl group indicates that there is a chlorine atom attached to a phenyl ring at the meta position relative to the imidazole. This compound is typically classified as an amine due to the presence of the methanamine functional group, which contributes to its basicity and potential reactivity. The molecular structure suggests that it may exhibit biological activity, possibly interacting with various biological targets due to its ability to form hydrogen bonds and engage in π-π stacking interactions. Its solubility and stability can vary depending on the solvent and environmental conditions. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the chlorine substituent, which may impart toxicity or environmental concerns. Overall, this compound's unique structure may make it of interest in pharmaceutical research and development.

Formula: C₁₀H₁₀ClN₃

InChI: InChI=1S/C10H10ClN3/c11-8-3-1-2-7(4-8)9-6-13-10(5-12)14-9/h1-4,6H,5,12H2,(H,13,14)

InChI key: InChIKey=DGZZEHNRTIGKPJ-UHFFFAOYSA-N

SMILES: C(N)C=1NC(=CN1)C2=CC(Cl)=CC=C2

Synonyms:

• 1H-Imidazole-2-methanamine, 5-(3-chlorophenyl)-
• 5-(3-Chlorophenyl)-1H-imidazole-2-methanamine

(4-(3-CHLOROPHENYL)-1H-IMIDAZOL-2-YL)METHANAMINE

CAS: 944897-81-8

Formula: C₁₀H₁₀ClN₃

Purity: 95.0%

Molecular weight: 207.66

Ref: 10-F304404