CAS 944898-09-3

5-(1-Methylethyl)-1H-imidazole-2-methanamine

Description:

5-(1-Methylethyl)-1H-imidazole-2-methanamine, with the CAS number 944898-09-3, is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This compound features an isopropyl group (1-methylethyl) and a methanamine functional group, contributing to its unique properties. It is likely to exhibit basic characteristics due to the presence of the amine group, which can accept protons. The imidazole moiety is known for its role in biological systems, particularly in the structure of amino acids like histidine, and can participate in various chemical reactions, including coordination with metal ions. The compound may have applications in pharmaceuticals or as a building block in organic synthesis, although specific applications would depend on its reactivity and biological activity. Its solubility, stability, and reactivity would be influenced by the functional groups present and the overall molecular structure. Safety and handling precautions should be observed, as with any chemical substance.

Formula: C₇H₁₃N₃

InChI: InChI=1S/C7H13N3/c1-5(2)6-4-9-7(3-8)10-6/h4-5H,3,8H2,1-2H3,(H,9,10)

InChI key: InChIKey=QEGOOMXWHGVBJN-UHFFFAOYSA-N

SMILES: C(C)(C)C=1NC(CN)=NC1

Synonyms:

• 1H-Imidazole-2-methanamine, 5-(1-methylethyl)-
• 5-(1-Methylethyl)-1H-imidazole-2-methanamine