
CAS 944898-42-4
:1-[2-(Methylthio)-1H-imidazol-5-yl]ethanone
Description:
1-[2-(Methylthio)-1H-imidazol-5-yl]ethanone, with the CAS number 944898-42-4, is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a methylthio group, which contributes to its unique properties, including potential reactivity and solubility characteristics. The ethanone moiety indicates the presence of a ketone functional group, which can participate in various chemical reactions, such as nucleophilic attacks. The compound's molecular structure suggests it may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility in organic solvents and stability under standard conditions are typical for similar compounds, although specific solubility and stability data would depend on experimental conditions. Overall, 1-[2-(Methylthio)-1H-imidazol-5-yl]ethanone is a compound that may have applications in medicinal chemistry and could serve as a building block for further chemical synthesis.
Formula:C6H8N2OS
InChI:InChI=1S/C6H8N2OS/c1-4(9)5-3-7-6(8-5)10-2/h3H,1-2H3,(H,7,8)
InChI key:InChIKey=HHMRHBVHRNBGPS-UHFFFAOYSA-N
SMILES:C(C)(=O)C=1NC(SC)=NC1
Synonyms:- Ethanone, 1-[2-(methylthio)-1H-imidazol-5-yl]-
- 1-[2-(Methylthio)-1H-imidazol-5-yl]ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
