CymitQuimica logo

CAS 944898-67-3

:

7-Bromo-2-benzoxazolecarboxylic acid

Description:
7-Bromo-2-benzoxazolecarboxylic acid is an organic compound characterized by its unique structure, which includes a benzoxazole ring and a carboxylic acid functional group. The presence of the bromine atom at the 7-position of the benzoxazole contributes to its reactivity and potential applications in various chemical reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its molecular structure allows for potential interactions in biological systems, making it of interest in medicinal chemistry and material science. The compound may also display specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Additionally, the bromine substituent can influence the compound's electronic properties, potentially affecting its behavior in chemical reactions and interactions with other molecules. Overall, 7-Bromo-2-benzoxazolecarboxylic acid is a versatile compound with applications in research and development within various fields of chemistry.
Formula:C8H4BrNO3
InChI:InChI=1S/C8H4BrNO3/c9-4-2-1-3-5-6(4)13-7(10-5)8(11)12/h1-3H,(H,11,12)
InChI key:InChIKey=HLHBIBCQALAVTP-UHFFFAOYSA-N
SMILES:BrC1=C2C(N=C(C(O)=O)O2)=CC=C1
Synonyms:
  • 2-Benzoxazolecarboxylic acid, 7-bromo-
  • 7-Bromo-2-benzoxazolecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.