CymitQuimica logo

CAS 944898-79-7

:

6-Bromo-2-benzoxazolecarboxaldehyde

Description:
6-Bromo-2-benzoxazolecarboxaldehyde is an organic compound characterized by its unique structure, which includes a benzoxazole ring and an aldehyde functional group. The presence of the bromine atom at the 6-position of the benzoxazole enhances its reactivity and can influence its biological activity. This compound typically appears as a solid at room temperature and is soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO). It is often used in synthetic organic chemistry as an intermediate for the preparation of various pharmaceuticals and agrochemicals. The aldehyde group allows for further functionalization, making it a versatile building block in chemical synthesis. Additionally, compounds containing benzoxazole derivatives are known for their potential applications in medicinal chemistry, particularly in the development of anti-cancer and anti-inflammatory agents. Safety data should be consulted for handling, as with many brominated compounds, there may be concerns regarding toxicity and environmental impact.
Formula:C8H4BrNO2
InChI:InChI=1S/C8H4BrNO2/c9-5-1-2-6-7(3-5)12-8(4-11)10-6/h1-4H
InChI key:InChIKey=AYXWVVLNNYYVJO-UHFFFAOYSA-N
SMILES:C(=O)C1=NC=2C(O1)=CC(Br)=CC2
Synonyms:
  • 2-Benzoxazolecarboxaldehyde, 6-bromo-
  • 6-Bromo-2-benzoxazolecarboxaldehyde
Found 4 products.