CAS 944898-91-3

5-Methyl-2-benzoxazolecarboxaldehyde

Description:

5-Methyl-2-benzoxazolecarboxaldehyde is an organic compound characterized by its benzoxazole ring structure, which is a fused bicyclic system containing both a benzene and an oxazole moiety. This compound features a methyl group at the 5-position and an aldehyde functional group at the 2-position of the benzoxazole ring. It is typically a pale yellow to light brown solid, exhibiting moderate solubility in organic solvents such as ethanol and dichloromethane, while being less soluble in water. The presence of the aldehyde group makes it reactive, particularly in condensation reactions and as a potential electrophile in various organic syntheses. Additionally, the compound may exhibit fluorescence properties, which can be useful in applications such as fluorescent probes or dyes. Its unique structure and functional groups contribute to its potential utility in pharmaceuticals, agrochemicals, and materials science. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₉H₇NO₂

InChI: InChI=1S/C9H7NO2/c1-6-2-3-8-7(4-6)10-9(5-11)12-8/h2-5H,1H3

InChI key: InChIKey=MIUXIBFASDUYMD-UHFFFAOYSA-N

SMILES: C(=O)C=1OC=2C(N1)=CC(C)=CC2

Synonyms:

• 2-Benzoxazolecarboxaldehyde, 5-methyl-
• 5-Methyl-2-benzoxazolecarboxaldehyde