CAS 944898-94-6

4-Fluoro-2-benzoxazolecarboxaldehyde

Description:

4-Fluoro-2-benzoxazolecarboxaldehyde is an organic compound characterized by its unique structure, which includes a benzoxazole ring and an aldehyde functional group. The presence of the fluorine atom at the 4-position of the benzoxazole contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. The aldehyde group is reactive, enabling it to participate in various chemical reactions, such as condensation and nucleophilic addition. Additionally, the compound may exhibit fluorescence properties, which can be useful in analytical applications. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, 4-Fluoro-2-benzoxazolecarboxaldehyde is a versatile compound with significant potential for research and development in chemical synthesis and biological applications.

Formula: C₈H₄FNO₂

InChI: InChI=1S/C8H4FNO2/c9-5-2-1-3-6-8(5)10-7(4-11)12-6/h1-4H

InChI key: InChIKey=AFARTHSPGNTNSS-UHFFFAOYSA-N

SMILES: FC1=C2C(OC(C=O)=N2)=CC=C1

Synonyms:

• 2-Benzoxazolecarboxaldehyde, 4-fluoro-
• 4-Fluoro-2-benzoxazolecarboxaldehyde