CAS 944899-22-3
:3-Iodo-7-(phenylmethoxy)-1H-indazole
Description:
3-Iodo-7-(phenylmethoxy)-1H-indazole is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of an iodine atom at the 3-position enhances its reactivity and potential applications in various chemical reactions, including electrophilic substitutions. The phenylmethoxy group at the 7-position contributes to the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. This compound may exhibit specific pharmacological properties, potentially acting as a ligand for various biological targets. Its molecular structure suggests potential applications in drug development, particularly in areas such as cancer research or neuropharmacology. Additionally, the compound's unique characteristics, including its molecular weight and solubility, would be important for its synthesis and application in laboratory settings. As with many indazole derivatives, the study of its properties and interactions is crucial for understanding its potential uses in pharmaceuticals and other fields.
Formula:C14H11IN2O
InChI:InChI=1S/C14H11IN2O/c15-14-11-7-4-8-12(13(11)16-17-14)18-9-10-5-2-1-3-6-10/h1-8H,9H2,(H,16,17)
InChI key:InChIKey=VQZURTFNQVMZSJ-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C3C(C(I)=NN3)=CC=C2
Synonyms:- 7-(BENZYLOXY)-3-IODO-1H-INDAZOLE
- 1H-Indazole, 3-iodo-7-(phenylmethoxy)-
- 1H-indazole, 3-iodo-7-(phenylmethoxy)-
- 3-Iodo-7-(phenylmethoxy)-1H-indazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
