CAS 944899-23-4

4-Methoxy-2-pyrimidineethanamine

Description:

4-Methoxy-2-pyrimidineethanamine is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing nitrogen atoms. The presence of a methoxy group (-OCH3) at the 4-position of the pyrimidine ring contributes to its chemical properties, including its polarity and potential for hydrogen bonding. The ethanamine moiety indicates that the compound has an amino group (-NH2) attached to an ethyl chain, which can influence its reactivity and solubility in various solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, and it may be explored for applications in pharmaceuticals or as a building block in organic synthesis. As with many nitrogen-containing heterocycles, it may also participate in various chemical reactions, including alkylation and acylation, due to the presence of the amino group. Safety and handling precautions should be observed, as with all chemical substances, particularly those with biological activity.

Formula: C₇H₁₁N₃O

InChI: InChI=1S/C7H11N3O/c1-11-7-3-5-9-6(10-7)2-4-8/h3,5H,2,4,8H2,1H3

InChI key: InChIKey=JNGLFUNIUKIGHZ-UHFFFAOYSA-N

SMILES: C(CN)C=1N=C(OC)C=CN1

Synonyms:

• 4-Methoxy-2-pyrimidineethanamine
• 2-Pyrimidineethanamine, 4-methoxy-