
CAS 944899-30-3
:3,4-Dihydro-6-methyl-2H-1-benzopyran-3-carboxylic acid
Description:
3,4-Dihydro-6-methyl-2H-1-benzopyran-3-carboxylic acid, with the CAS number 944899-30-3, is a chemical compound characterized by its bicyclic structure, which includes a benzopyran moiety. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of a methyl group at the 6-position of the benzopyran ring influences its physical and chemical properties, such as solubility and stability. Typically, compounds of this class may exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The bicyclic structure can also affect the compound's interaction with biological targets, potentially leading to various therapeutic applications. Additionally, the compound's synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for structural elucidation. Overall, 3,4-Dihydro-6-methyl-2H-1-benzopyran-3-carboxylic acid represents a unique chemical entity with potential implications in various scientific fields.
Formula:C11H12O3
InChI:InChI=1S/C11H12O3/c1-7-2-3-10-8(4-7)5-9(6-14-10)11(12)13/h2-4,9H,5-6H2,1H3,(H,12,13)
InChI key:InChIKey=UUHUXJJYCVPIDW-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CC=2C(OC1)=CC=C(C)C2
Synonyms:- 2H-1-Benzopyran-3-carboxylic acid, 3,4-dihydro-6-methyl-
- 3,4-Dihydro-6-methyl-2H-1-benzopyran-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.