
CAS 944899-45-0
:3,4-Dihydro-6-methyl-2H-1-benzopyran-3-methanamine
Description:
3,4-Dihydro-6-methyl-2H-1-benzopyran-3-methanamine, with the CAS number 944899-45-0, is a chemical compound that belongs to the class of benzopyrans, which are characterized by a fused benzene and pyran ring structure. This specific compound features a dihydrobenzopyran framework, indicating the presence of a saturated ring system, along with a methyl group and a methanamine substituent. The presence of the methanamine group suggests potential for biological activity, possibly influencing neurotransmitter systems or other physiological pathways. The compound's structure may confer specific solubility and reactivity characteristics, making it of interest in medicinal chemistry and pharmacology. Additionally, its unique arrangement of functional groups could lead to varied interactions with biological targets, warranting further investigation into its potential applications. As with many organic compounds, its stability, reactivity, and biological effects would depend on environmental conditions and the presence of other substances.
Formula:C11H15NO
InChI:InChI=1S/C11H15NO/c1-8-2-3-11-10(4-8)5-9(6-12)7-13-11/h2-4,9H,5-7,12H2,1H3
InChI key:InChIKey=DRZHDMMTUUVXMM-UHFFFAOYSA-N
SMILES:C(N)C1CC=2C(OC1)=CC=C(C)C2
Synonyms:- 3,4-Dihydro-6-methyl-2H-1-benzopyran-3-methanamine
- 2H-1-Benzopyran-3-methanamine, 3,4-dihydro-6-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.