
CAS 944899-60-9
:7-Chloro-2H-1-benzopyran-3(4H)-one
Description:
7-Chloro-2H-1-benzopyran-3(4H)-one, with the CAS number 944899-60-9, is a synthetic organic compound characterized by its benzopyran structure, which consists of a fused benzene and pyran ring. This compound features a chlorine atom at the 7-position and a carbonyl group at the 3-position of the pyran ring, contributing to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit solubility in organic solvents, depending on the specific conditions. The presence of the chlorine atom can influence its electronic properties and interactions with biological targets, making it of interest in medicinal chemistry and drug development. Additionally, compounds of this class may exhibit various pharmacological activities, including anti-inflammatory or antimicrobial properties. As with many synthetic organic compounds, safety data and handling precautions should be considered, as they may pose health risks if not managed properly.
Formula:C9H7ClO2
InChI:InChI=1S/C9H7ClO2/c10-7-2-1-6-3-8(11)5-12-9(6)4-7/h1-2,4H,3,5H2
InChI key:InChIKey=GRMNWIUZRITVQF-UHFFFAOYSA-N
SMILES:O=C1CC=2C(=CC(Cl)=CC2)OC1
Synonyms:- 7-Chloro-2H-1-benzopyran-3(4H)-one
- 2H-1-Benzopyran-3(4H)-one, 7-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
