CAS 944900-35-0
:2-(4-Morpholinyl)-4-pyrimidinecarboxaldehyde
Description:
2-(4-Morpholinyl)-4-pyrimidinecarboxaldehyde is a chemical compound characterized by its pyrimidine ring structure, which is substituted with a morpholine group and an aldehyde functional group. The presence of the morpholine moiety contributes to its potential as a pharmacophore in medicinal chemistry, as morpholines are known for their ability to enhance solubility and bioavailability. The aldehyde group is reactive and can participate in various chemical reactions, including condensation and reduction, making the compound versatile in synthetic applications. This compound is typically used in research and development, particularly in the fields of drug discovery and organic synthesis. Its molecular structure suggests potential interactions with biological targets, which may lead to the development of therapeutic agents. Additionally, the compound's properties, such as solubility, stability, and reactivity, can be influenced by the surrounding environment, including pH and solvent conditions. Overall, 2-(4-Morpholinyl)-4-pyrimidinecarboxaldehyde represents a valuable scaffold in the exploration of new chemical entities.
Formula:C9H11N3O2
InChI:InChI=1S/C9H11N3O2/c13-7-8-1-2-10-9(11-8)12-3-5-14-6-4-12/h1-2,7H,3-6H2
InChI key:InChIKey=GBCDUCDSMVPGKL-UHFFFAOYSA-N
SMILES:C(=O)C1=NC(=NC=C1)N2CCOCC2
Synonyms:- 4-Pyrimidinecarboxaldehyde, 2-(4-morpholinyl)-
- 2-(4-Morpholinyl)-4-pyrimidinecarboxaldehyde
- 2-Morpholinopyrimidine-4-carbaldehyde
- 2-Morpholino-4-pyrimidinecarboxaldehyde
- 2-(Morpholin-4-yl)pyrimidine-4-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
