CymitQuimica logo

CAS 944900-36-1

:

5-Amino-2-(trifluoromethyl)-4-pyridinecarboxaldehyde

Description:
5-Amino-2-(trifluoromethyl)-4-pyridinecarboxaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features an amino group (-NH2) and a trifluoromethyl group (-CF3) attached to the pyridine ring, as well as an aldehyde functional group (-CHO) at the 4-position. The presence of the trifluoromethyl group significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its reactivity and biological activity. The amino group can participate in hydrogen bonding, making the compound potentially useful in various chemical reactions, including nucleophilic substitutions. Additionally, the aldehyde functionality allows for further derivatization, making it a versatile intermediate in organic synthesis. This compound may have applications in pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on its reactivity and biological interactions. As with many fluorinated compounds, it may exhibit unique properties such as increased stability and altered solubility compared to non-fluorinated analogs.
Formula:C7H5F3N2O
InChI:InChI=1S/C7H5F3N2O/c8-7(9,10)6-1-4(3-13)5(11)2-12-6/h1-3H,11H2
InChI key:InChIKey=ADZNBPVPSRDPCU-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(C=O)=C(N)C=N1
Synonyms:
  • 5-Amino-2-(trifluoromethyl)-4-pyridinecarboxaldehyde
  • 5-Amino-2-trifluoromethyl-pyridine-4-carbaldehyde
  • 4-Pyridinecarboxaldehyde, 5-amino-2-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.