CAS 944900-49-6

Ethyl 4-bromo-1H-imidazole-2-carboxylate

Description:

Ethyl 4-bromo-1H-imidazole-2-carboxylate is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a bromine atom at the 4-position of the imidazole ring contributes to its reactivity and potential applications in organic synthesis. The ethyl ester functional group at the 2-position enhances its solubility in organic solvents and may influence its biological activity. This compound is typically used in medicinal chemistry and as an intermediate in the synthesis of various pharmaceuticals. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug development. Additionally, the compound may exhibit specific physical properties such as melting point, boiling point, and solubility, which are important for its handling and application in laboratory settings. Safety data should be consulted to ensure proper handling, as halogenated compounds can pose health risks. Overall, Ethyl 4-bromo-1H-imidazole-2-carboxylate is a versatile compound with significant implications in chemical research and development.

Formula: C₆H₇BrN₂O₂

InChI: InChI=1/C6H7BrN2O2/c1-2-11-6(10)5-8-3-4(7)9-5/h3H,2H2,1H3,(H,8,9)

SMILES: CCOC(=O)c1[nH]cc(Br)n1

Synonyms:

• 1H-imidazole-2-carboxylic acid, 4-bromo-, ethyl ester

Ethyl 5-bromo-1H-imidazole-2-carboxylate

CAS: 944900-49-6

Formula: C₆H₇BrN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 219.0360

Ref: IN-DA005WTY

Ethyl 5-bromo-1H-imidazole-2-carboxylate

CAS: 944900-49-6

Ethyl 5-bromo-1H-imidazole-2-carboxylate

Purity: 97%

Molecular weight: 219.04g/mol

Ref: 54-OR1036331

Ethyl 5-bromo-1H-imidazole-2-carboxylate

CAS: 944900-49-6

Formula: C₆H₇BrN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 219.038

Ref: 10-F319799