CAS 944900-52-1

2-amino-1,3-oxazole-4-carboxylic acid

Description:

2-Amino-1,3-oxazole-4-carboxylic acid is a heterocyclic compound characterized by the presence of an oxazole ring, which is a five-membered aromatic ring containing both nitrogen and oxygen atoms. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) attached to the oxazole ring, contributing to its acidic and basic properties. The presence of these functional groups allows for potential interactions in biological systems, making it of interest in medicinal chemistry and biochemistry. The compound is typically a white to off-white solid and is soluble in polar solvents, which is common for many carboxylic acids. Its structure suggests potential applications in pharmaceuticals, particularly as a building block for drug synthesis or as a bioactive molecule. Additionally, the oxazole moiety may impart specific biological activities, making it a subject of research in various fields, including agrochemicals and materials science. As with many organic compounds, its stability and reactivity can be influenced by environmental conditions such as pH and temperature.

Formula: C₄H₄N₂O₃

InChI: InChI=1/C4H4N2O3/c5-4-6-2(1-9-4)3(7)8/h1H,(H2,5,6)(H,7,8)

SMILES: c1c(C(=O)O)[nH]c(=N)o1

Synonyms:

• 4-Oxazolecarboxylic Acid, 2-Amino-

2-Aminooxazole-4-carboxylic acid

CAS: 944900-52-1

Formula: C₄H₄N₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 128.0862

Ref: IN-DA00H6CX

2-Amino-1,3-oxazole-4-carboxylic acid

CAS: 944900-52-1

2-Amino-1,3-oxazole-4-carboxylic acid

Purity: 95%

Molecular weight: 128.09g/mol

Ref: 54-OR30773

2-Amino-1,3-oxazole-4-carboxylic acid

CAS: 944900-52-1

Formula: C₄H₄N₂O₃

Purity: 98%

Color and Shape: No data available.

Molecular weight: 128.087

Ref: 10-F066221