
CAS 944900-71-4
:4-(Dimethoxymethyl)-2-pyrimidinemethanol
Description:
4-(Dimethoxymethyl)-2-pyrimidinemethanol is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing nitrogen atoms. This compound features a hydroxymethyl group and two methoxy groups attached to the pyrimidine ring, contributing to its unique reactivity and solubility properties. The presence of the hydroxymethyl group suggests potential for hydrogen bonding, which can influence its interactions in biological systems or chemical reactions. The dimethoxy groups enhance its lipophilicity, potentially affecting its pharmacokinetic properties if considered for medicinal applications. Additionally, the compound may exhibit specific biological activities due to its structural features, making it of interest in pharmaceutical research. Its CAS number, 944900-71-4, allows for precise identification in chemical databases and literature. Overall, this compound's characteristics make it a subject of interest in both synthetic chemistry and potential therapeutic applications.
Formula:C8H12N2O3
InChI:InChI=1S/C8H12N2O3/c1-12-8(13-2)6-3-4-9-7(5-11)10-6/h3-4,8,11H,5H2,1-2H3
InChI key:InChIKey=ADUDSOKKWDPREJ-UHFFFAOYSA-N
SMILES:C(OC)(OC)C1=NC(CO)=NC=C1
Synonyms:- 4-(Dimethoxymethyl)-2-pyrimidinemethanol
- 2-Pyrimidinemethanol, 4-(dimethoxymethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.