CAS 944900-76-9

4-methoxy-1H-pyrrolo[3,2-c]pyridine

Description:

4-Methoxy-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a methoxy group (-OCH3) at the 4-position enhances its solubility and reactivity, making it a valuable intermediate in organic synthesis and medicinal chemistry. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO). Its molecular structure allows for potential interactions with biological targets, which has led to interest in its pharmacological applications. The compound may exhibit various biological activities, including antimicrobial or anticancer properties, although specific studies would be necessary to confirm these effects. Additionally, its stability under standard laboratory conditions makes it suitable for further research and development in drug discovery and material science. As with any chemical substance, proper handling and safety precautions should be observed due to potential toxicity or reactivity.

Formula: C₈H₈N₂O

InChI: InChI=1/C8H8N2O/c1-11-8-6-2-4-9-7(6)3-5-10-8/h2-5,9H,1H3

SMILES: COc1c2cc[nH]c2ccn1

Synonyms:

• 1H-Pyrrolo[3,2-c]pyridine, 4-Methoxy-
• 4-Metho×y-1H-pyrrolo[3,2-c]pyridine
• Methyl 1H-pyrrolo[3,2-c]pyridin-4-yl ether
• 4-METHOXY-5-AZAINDOLE
• 4-Methoxy-1H-pyrrolo[3,2-c]pyridine

4-Methoxy-1H-pyrrolo[3,2-c]pyridine

CAS: 944900-76-9

Formula: C₈H₈N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 148.1619

Ref: IN-DA005WTX

4-Methoxy-1H-pyrrolo[3,2-c]pyridine

CAS: 944900-76-9

4-Methoxy-1H-pyrrolo[3,2-c]pyridine

Purity: 97%

Molecular weight: 148.16g/mol

Ref: 54-OR81833

4-Methoxy-1H-pyrrolo[3,2-c]pyridine

CAS: 944900-76-9

Formula: C₈H₈N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 148.165

Ref: 10-F209022