CAS 944901-08-0

2-(1-Piperidinyl)-4-pyrimidinemethanamine

Description:

2-(1-Piperidinyl)-4-pyrimidinemethanamine, identified by its CAS number 944901-08-0, is a chemical compound characterized by its unique structure, which includes a piperidine ring and a pyrimidine moiety. This compound typically exhibits properties associated with amines, such as basicity due to the presence of the amine functional group. It is likely to be a solid at room temperature, with potential solubility in polar solvents, given the presence of the piperidine and amine groups. The compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. Its synthesis and reactivity may involve standard organic reactions, including nucleophilic substitutions and coupling reactions. As with many organic compounds, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, 2-(1-Piperidinyl)-4-pyrimidinemethanamine represents a class of compounds that may have significant implications in drug discovery and development.

Formula: C₁₀H₁₆N₄

InChI: InChI=1S/C10H16N4/c11-8-9-4-5-12-10(13-9)14-6-2-1-3-7-14/h4-5H,1-3,6-8,11H2

InChI key: InChIKey=VNTOGTSCGVKRIN-UHFFFAOYSA-N

SMILES: C(N)C1=NC(=NC=C1)N2CCCCC2

Synonyms:

• 4-Pyrimidinemethanamine, 2-(1-piperidinyl)-
• 2-(1-Piperidinyl)-4-pyrimidinemethanamine