
CAS 944901-21-7
:3-Fluoro-7,8-dihydro-5(6H)-quinolinone
Description:
3-Fluoro-7,8-dihydro-5(6H)-quinolinone is a chemical compound characterized by its unique quinolinone structure, which features a fused bicyclic system. The presence of a fluorine atom at the 3-position contributes to its reactivity and potential applications in medicinal chemistry. This compound typically exhibits a range of biological activities, making it of interest in pharmaceutical research. Its molecular structure includes a carbonyl group, which is characteristic of quinolinones, and the dihydro form indicates the presence of saturated carbon atoms in the ring system. The compound is likely to be a solid at room temperature and may have moderate solubility in organic solvents. Its properties, such as melting point, boiling point, and spectral characteristics, would be influenced by the fluorine substitution and the overall molecular conformation. As with many quinolinones, it may serve as a scaffold for the development of various bioactive molecules, particularly in the fields of anti-infective and anticancer agents. Safety and handling precautions should be observed due to potential toxicity associated with fluorinated compounds.
Formula:C9H8FNO
InChI:InChI=1S/C9H8FNO/c10-6-4-7-8(11-5-6)2-1-3-9(7)12/h4-5H,1-3H2
InChI key:InChIKey=XMIOPVYZIONVGX-UHFFFAOYSA-N
SMILES:O=C1C=2C(=NC=C(F)C2)CCC1
Synonyms:- 5(6H)-Quinolinone, 3-fluoro-7,8-dihydro-
- 3-Fluoro-7,8-dihydro-5(6H)-quinolinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.