
CAS 944901-24-0
:1-Methyl-1H-1,2,3-triazole-5-methanamine
Description:
1-Methyl-1H-1,2,3-triazole-5-methanamine is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound features a methyl group attached to the triazole nitrogen and a methanamine group, which contributes to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of both nitrogen functionalities in the triazole and amine groups may impart unique properties such as enhanced solubility in polar solvents and the ability to form hydrogen bonds, making it a candidate for biological activity. Additionally, the compound's structure suggests potential for coordination with metal ions, which could be relevant in catalysis or material science. Its CAS number, 944901-24-0, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, 1-Methyl-1H-1,2,3-triazole-5-methanamine is a versatile compound with promising applications due to its unique structural features.
Formula:C4H8N4
InChI:InChI=1S/C4H8N4/c1-8-4(2-5)3-6-7-8/h3H,2,5H2,1H3
InChI key:InChIKey=PVWKPXNAMNJOFY-UHFFFAOYSA-N
SMILES:C(N)C=1N(C)N=NC1
Synonyms:- 1-Methyl-1H-1,2,3-triazole-5-methanamine
- 1H-1,2,3-Triazole-5-methanamine, 1-methyl-
- (1-Methyl-1H-1,2,3-triazol-5-yl)methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.