CAS 944901-34-2
:2-(Chloromethyl)-4-pyrimidinecarboxaldehyde
Description:
2-(Chloromethyl)-4-pyrimidinecarboxaldehyde is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing nitrogen atoms. This compound features a chloromethyl group (-CH2Cl) and an aldehyde functional group (-CHO) attached to the pyrimidine ring, contributing to its reactivity and potential applications in organic synthesis. The presence of the chloromethyl group makes it a useful intermediate for further chemical modifications, while the aldehyde group can participate in various reactions, such as condensation and nucleophilic addition. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its reactivity profile allows it to be utilized in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of chlorine and the aldehyde functional group, which can be irritating or harmful upon exposure.
Formula:C6H5ClN2O
InChI:InChI=1S/C6H5ClN2O/c7-3-6-8-2-1-5(4-10)9-6/h1-2,4H,3H2
InChI key:InChIKey=QSNPGEXYAWLFFL-UHFFFAOYSA-N
SMILES:C(=O)C1=NC(CCl)=NC=C1
Synonyms:- 4-Pyrimidinecarboxaldehyde, 2-(chloromethyl)-
- 2-(Chloromethyl)-4-pyrimidinecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
