CAS 944901-36-4
:1-(3-Chlorophenyl)-1H-1,2,3-triazole-4-methanamine
Description:
1-(3-Chlorophenyl)-1H-1,2,3-triazole-4-methanamine is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a chlorophenyl group, indicating the presence of a chlorine atom on a phenyl ring, which can influence its reactivity and biological activity. The methanamine functional group contributes to its potential as a building block in organic synthesis and medicinal chemistry. The presence of the triazole moiety often imparts unique properties, such as enhanced stability and the ability to form hydrogen bonds, making it of interest in various applications, including pharmaceuticals and agrochemicals. Additionally, the chlorine substituent can enhance lipophilicity and modulate the compound's interaction with biological targets. Overall, this compound's structural features suggest potential utility in drug development, particularly in the search for new therapeutic agents.
Formula:C9H9ClN4
InChI:InChI=1S/C9H9ClN4/c10-7-2-1-3-9(4-7)14-6-8(5-11)12-13-14/h1-4,6H,5,11H2
InChI key:InChIKey=SLHKZKOHFRRJMV-UHFFFAOYSA-N
SMILES:C(N)C1=CN(N=N1)C2=CC(Cl)=CC=C2
Synonyms:- 1-(3-Chlorophenyl)-1H-1,2,3-triazole-4-methanamine
- 1H-1,2,3-Triazole-4-methanamine, 1-(3-chlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.