CymitQuimica logo

CAS 944901-41-1

:

4-(Chloromethyl)-2-(1-methylethyl)pyrimidine

Description:
4-(Chloromethyl)-2-(1-methylethyl)pyrimidine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The presence of a chloromethyl group at the 4-position and an isopropyl group at the 2-position contributes to its unique reactivity and potential applications in organic synthesis. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which makes it useful in various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals. The chloromethyl group can serve as a reactive site for nucleophilic substitution reactions, while the isopropyl group may influence the compound's steric and electronic properties. Safety precautions should be taken when handling this substance, as it may pose health risks due to its chlorinated nature and potential reactivity.
Formula:C8H11ClN2
InChI:InChI=1S/C8H11ClN2/c1-6(2)8-10-4-3-7(5-9)11-8/h3-4,6H,5H2,1-2H3
InChI key:InChIKey=LAENIQWRTBCLNJ-UHFFFAOYSA-N
SMILES:C(C)(C)C=1N=C(CCl)C=CN1
Synonyms:
  • Pyrimidine, 4-(chloromethyl)-2-(1-methylethyl)-
  • 4-(Chloromethyl)-2-(1-methylethyl)pyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.