CymitQuimica logo

CAS 944901-47-7

:

4-(Chloromethyl)-6-(trifluoromethyl)pyrimidine

Description:
4-(Chloromethyl)-6-(trifluoromethyl)pyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a chloromethyl group (-CH2Cl) at the 4-position and a trifluoromethyl group (-CF3) at the 6-position of the pyrimidine ring, which significantly influences its chemical reactivity and physical properties. The presence of the trifluoromethyl group imparts unique electronic characteristics, enhancing the compound's lipophilicity and potentially its biological activity. The chloromethyl group can serve as a reactive site for further chemical modifications, making it useful in synthetic organic chemistry. This compound is typically used in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. Its properties, such as solubility and stability, can vary depending on the solvent and conditions used, making it important to consider these factors in practical applications.
Formula:C6H4ClF3N2
InChI:InChI=1S/C6H4ClF3N2/c7-2-4-1-5(6(8,9)10)12-3-11-4/h1,3H,2H2
InChI key:InChIKey=FKYOOPNTSUPIEQ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(CCl)N=CN1
Synonyms:
  • 4-(Chloromethyl)-6-(trifluoromethyl)pyrimidine
  • Pyrimidine, 4-(chloromethyl)-6-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.