CAS 944901-59-1

2-Chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine

Description:

2-Chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine is a heterocyclic compound characterized by its fused pyridine and pyrimidine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 2-position enhances its reactivity and potential for forming various derivatives. This compound typically exhibits a solid-state at room temperature and is soluble in polar organic solvents, which is common for many nitrogen-containing heterocycles. Its structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The compound may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, due to the electron-withdrawing nature of the chlorine substituent. Additionally, its molecular framework allows for interactions with biological targets, which could lead to pharmacological applications. Safety data and handling precautions should be considered, as with any chemical substance, particularly those with halogen substituents. Overall, 2-Chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine represents a versatile scaffold in organic synthesis and medicinal chemistry.

Formula: C₇H₈ClN₃

InChI: InChI=1/C7H8ClN3/c8-7-10-4-5-3-9-2-1-6(5)11-7/h4,9H,1-3H2

SMILES: C1CNCc2cnc(Cl)nc12

Synonyms:

• Pyrido[4,3-d]pyrimidine, 2-chloro-5,6,7,8-tetrahydro-

2-Chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine

CAS: 944901-59-1

Formula: C₇H₈ClN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 169.6115

Ref: IN-DA003GYB

2-Chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine

CAS: 944901-59-1

Formula: C₇H₈ClN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 169.61

Ref: 10-F217465