CymitQuimica logo

CAS 944901-88-6

:

2-(Hydroxymethyl)-6-(trifluoromethyl)-4-pyrimidinecarboxaldehyde

Description:
2-(Hydroxymethyl)-6-(trifluoromethyl)-4-pyrimidinecarboxaldehyde is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a hydroxymethyl group (-CH2OH) and a trifluoromethyl group (-CF3) attached to the pyrimidine ring, contributing to its unique chemical properties. The presence of the aldehyde functional group (-CHO) at the 4-position enhances its reactivity, making it useful in various synthetic applications. The trifluoromethyl group is known for imparting lipophilicity and influencing the compound's biological activity. This substance is typically used in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. Its specific properties, such as solubility, stability, and reactivity, can vary based on the surrounding conditions and the presence of other functional groups. Overall, this compound exemplifies the complexity and versatility of heterocyclic chemistry in medicinal applications.
Formula:C7H5F3N2O2
InChI:InChI=1S/C7H5F3N2O2/c8-7(9,10)5-1-4(2-13)11-6(3-14)12-5/h1-2,14H,3H2
InChI key:InChIKey=SBVSEJLFFRCLHU-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C=O)N=C(CO)N1
Synonyms:
  • 4-Pyrimidinecarboxaldehyde, 2-(hydroxymethyl)-6-(trifluoromethyl)-
  • 2-(Hydroxymethyl)-6-(trifluoromethyl)-4-pyrimidinecarboxaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.