
CAS 944901-93-3
:3-(3-Methoxyphenyl)-1,2,4-oxadiazole-5-carboxaldehyde
Description:
3-(3-Methoxyphenyl)-1,2,4-oxadiazole-5-carboxaldehyde is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a carboxaldehyde functional group, which is known for its reactivity and ability to participate in various chemical reactions, including condensation and oxidation. The presence of the methoxyphenyl group enhances its solubility and may influence its biological activity, making it of interest in medicinal chemistry. The oxadiazole moiety is often associated with diverse pharmacological properties, including antimicrobial and anti-inflammatory activities. Additionally, the compound's structure suggests potential applications in organic synthesis and material science, particularly in the development of fluorescent materials or as intermediates in the synthesis of more complex molecules. Overall, 3-(3-Methoxyphenyl)-1,2,4-oxadiazole-5-carboxaldehyde is a versatile compound with significant potential in various fields of research and application.
Formula:C10H8N2O3
InChI:InChI=1S/C10H8N2O3/c1-14-8-4-2-3-7(5-8)10-11-9(6-13)15-12-10/h2-6H,1H3
InChI key:InChIKey=VGNMCMJMJIHFDV-UHFFFAOYSA-N
SMILES:C(=O)C1=NC(=NO1)C2=CC(OC)=CC=C2
Synonyms:- 3-(3-Methoxyphenyl)-1,2,4-oxadiazole-5-carboxaldehyde
- 1,2,4-Oxadiazole-5-carboxaldehyde, 3-(3-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.