
CAS 944901-96-6
:3-(2-Fluorophenyl)-1,2,4-oxadiazole-5-carboxaldehyde
Description:
3-(2-Fluorophenyl)-1,2,4-oxadiazole-5-carboxaldehyde is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. The presence of a carboxaldehyde functional group (-CHO) at the 5-position of the oxadiazole contributes to its reactivity, making it useful in various synthetic applications. The substitution of a fluorophenyl group at the 3-position enhances its electronic properties, potentially influencing its behavior in biological systems and chemical reactions. This compound may exhibit interesting photophysical properties, making it a candidate for applications in materials science, such as in organic light-emitting diodes (OLEDs) or as a fluorescent probe. Additionally, the fluorine atom can impart unique characteristics, such as increased lipophilicity and altered metabolic stability, which can be advantageous in medicinal chemistry. Overall, 3-(2-Fluorophenyl)-1,2,4-oxadiazole-5-carboxaldehyde is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C9H5FN2O2
InChI:InChI=1S/C9H5FN2O2/c10-7-4-2-1-3-6(7)9-11-8(5-13)14-12-9/h1-5H
InChI key:InChIKey=FKYXIIXBSQTLFL-UHFFFAOYSA-N
SMILES:FC1=C(C=2N=C(C=O)ON2)C=CC=C1
Synonyms:- 1,2,4-Oxadiazole-5-carboxaldehyde, 3-(2-fluorophenyl)-
- 3-(2-Fluorophenyl)-1,2,4-oxadiazole-5-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.