CAS 944902-00-5

Methyl 4-(aminomethyl)-2-pyrimidinecarboxylate

Description:

Methyl 4-(aminomethyl)-2-pyrimidinecarboxylate is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 2 and 4. This compound features a carboxylate group, which contributes to its acidic properties, and an aminomethyl substituent that enhances its potential for hydrogen bonding and reactivity. The methyl ester functional group indicates that it can undergo hydrolysis to yield the corresponding carboxylic acid. This compound is of interest in medicinal chemistry and may exhibit biological activity due to its structural features, which can interact with various biological targets. Its solubility and stability can vary depending on the pH and solvent conditions, making it important to consider these factors in practical applications. Additionally, the presence of both nitrogen and oxygen atoms in its structure suggests potential for diverse chemical reactivity, including nucleophilic substitutions and coupling reactions. Overall, Methyl 4-(aminomethyl)-2-pyrimidinecarboxylate is a versatile compound with potential applications in pharmaceuticals and organic synthesis.

Formula: C₇H₉N₃O₂

InChI: InChI=1S/C7H9N3O2/c1-12-7(11)6-9-3-2-5(4-8)10-6/h2-3H,4,8H2,1H3

InChI key: InChIKey=YPGTXNSRBWZWGI-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1N=C(CN)C=CN1

Synonyms:

• 2-Pyrimidinecarboxylic acid, 4-(aminomethyl)-, methyl ester
• Methyl 4-(aminomethyl)-2-pyrimidinecarboxylate