CAS 944902-11-8

2-Chloro-4-quinazolinecarboxylic acid

Description:

2-Chloro-4-quinazolinecarboxylic acid is a heterocyclic compound characterized by the presence of a quinazoline ring system, which consists of a fused benzene and pyrimidine structure. The compound features a carboxylic acid functional group and a chlorine substituent at the 2-position of the quinazoline ring. This structure contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmaceutical research. The presence of the chlorine atom can influence the compound's reactivity and solubility, while the carboxylic acid group can participate in hydrogen bonding and enhance its interaction with biological targets. Typically, compounds like this may exhibit properties such as moderate to high polarity, which can affect their solubility in various solvents. Additionally, the compound may possess potential applications in the development of therapeutic agents, particularly in the treatment of diseases where quinazoline derivatives have shown efficacy. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₉H₅ClN₂O₂

InChI: InChI=1S/C9H5ClN2O2/c10-9-11-6-4-2-1-3-5(6)7(12-9)8(13)14/h1-4H,(H,13,14)

InChI key: InChIKey=FPZJKAIFJVJOIS-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(N=C(Cl)N1)C=CC=C2

Synonyms:

• 2-Chloro-4-quinazolinecarboxylic acid
• 4-Quinazolinecarboxylic acid, 2-chloro-

2-chloroquinazoline-4-carboxylic acid

CAS: 944902-11-8

Formula: C₉H₅ClN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 208.6012

Ref: IN-DA00II94