CAS 944902-32-3

5-Chloro-α-methyl-2-pyrimidinemethanamine

Description:

5-Chloro-α-methyl-2-pyrimidinemethanamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 2 and 4. The presence of a chlorine atom at the 5-position and an α-methyl group contributes to its unique reactivity and properties. This compound is typically classified as an amine due to the presence of the amine functional group (-NH2), which can participate in various chemical reactions, including nucleophilic substitutions and formation of salts. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as pyrimidine derivatives are often explored for their biological activities. The compound's solubility, stability, and reactivity can be influenced by the substituents on the pyrimidine ring, making it a subject of interest in synthetic organic chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₆H₈ClN₃

InChI: InChI=1S/C6H8ClN3/c1-4(8)6-9-2-5(7)3-10-6/h2-4H,8H2,1H3

InChI key: InChIKey=RIVDKPXWXNEIHC-UHFFFAOYSA-N

SMILES: C(C)(N)C=1N=CC(Cl)=CN1

Synonyms:

• 5-Chloro-α-methyl-2-pyrimidinemethanamine
• 2-Pyrimidinemethanamine, 5-chloro-α-methyl-