CymitQuimica logo

CAS 944902-47-0

:

2-(Aminomethyl)-4(3H)-pyrimidinone

Description:
2-(Aminomethyl)-4(3H)-pyrimidinone, identified by its CAS number 944902-47-0, is a heterocyclic organic compound featuring a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound is characterized by the presence of an amino group (-NH2) and a hydroxymethyl group (-CH2OH) attached to the pyrimidine structure, contributing to its reactivity and potential biological activity. It is typically a white to off-white solid and is soluble in polar solvents, which is common for many pyrimidine derivatives. The compound may exhibit properties such as being a potential intermediate in the synthesis of pharmaceuticals or agrochemicals, given the importance of pyrimidine derivatives in medicinal chemistry. Its specific applications and biological activities would depend on further studies, including its interaction with biological targets and its pharmacokinetic properties. As with many chemical substances, safety data should be reviewed before handling, as it may pose health risks.
Formula:C5H7N3O
InChI:InChI=1S/C5H7N3O/c6-3-4-7-2-1-5(9)8-4/h1-2H,3,6H2,(H,7,8,9)
InChI key:InChIKey=VXYALPOBJGYTEE-UHFFFAOYSA-N
SMILES:C(N)C=1NC(=O)C=CN1
Synonyms:
  • 2-(Aminomethyl)-4(3H)-pyrimidinone
  • 4(3H)-Pyrimidinone, 2-(aminomethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.