CAS 944902-64-1
:4-chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine
Description:
4-Chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine is a heterocyclic organic compound characterized by its fused pyridine and pyrimidine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 4-position enhances its reactivity and potential for forming various derivatives. This compound typically exhibits a solid state at room temperature and is soluble in polar organic solvents, making it suitable for various chemical reactions and applications. Its structure suggests potential biological activity, which may include interactions with biological targets, making it of interest in medicinal chemistry. The compound's molecular framework allows for the possibility of forming hydrogen bonds and participating in π-π stacking interactions, which are important in drug design and development. Additionally, the presence of multiple nitrogen atoms in the ring structure can influence its electronic properties, potentially affecting its behavior in biological systems. Overall, 4-chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine is a versatile compound with implications in both synthetic and medicinal chemistry.
Formula:C7H8ClN3
InChI:InChI=1/C7H8ClN3/c8-7-5-3-9-2-1-6(5)10-4-11-7/h4,9H,1-3H2
SMILES:C1CNCc2c1ncnc2Cl
Synonyms:- Pyrido[4,3-D]Pyrimidine, 4-Chloro-5,6,7,8-Tetrahydro-
- 4-Chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
