CAS 944903-06-4

3-bromo-6-chloro-1H-pyrazolo[3,4-d]pyrimidine

Description:

3-bromo-6-chloro-1H-pyrazolo[3,4-d]pyrimidine is a heterocyclic compound characterized by its fused pyrazole and pyrimidine rings, which contribute to its unique chemical properties. The presence of bromine and chlorine substituents enhances its reactivity and potential for forming various derivatives. This compound typically exhibits moderate to high solubility in polar organic solvents, making it suitable for various synthetic applications. Its structure suggests potential biological activity, often explored in medicinal chemistry for its role as a scaffold in drug development. The compound may also participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, due to the presence of halogen atoms. Additionally, its stability under standard laboratory conditions allows for further manipulation and study. Overall, 3-bromo-6-chloro-1H-pyrazolo[3,4-d]pyrimidine is of interest in both academic research and industrial applications, particularly in the fields of pharmaceuticals and agrochemicals.

Formula: C₅H₂BrClN₄

InChI: InChI=1/C5H2BrClN4/c6-3-2-1-8-5(7)9-4(2)11-10-3/h1H,(H,8,9,10,11)

SMILES: c1c2c(Br)n[nH]c2nc(Cl)n1

Synonyms:

• 1H-Pyrazolo[3,4-d]pyrimidine, 3-bromo-6-chloro-
• 3-Bromo-6-chloro-1H-pyrazolo[3,4-d]pyrimidine

3-Bromo-6-chloro-1H-pyrazolo[3,4-d]pyrimidine

CAS: 944903-06-4

Formula: C₅H₂BrClN₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 233.4532

Ref: IN-DA006AB0

3-Bromo-6-chloro-1H-pyrazolo[3,4-d]pyrimidine

CAS: 944903-06-4

3-Bromo-6-chloro-1H-pyrazolo[3,4-d]pyrimidine

Purity: 97%

Molecular weight: 233.45g/mol

Ref: 54-OR84944

3-BROMO-6-CHLORO-1H-PYRAZOLO[3,4-D]PYRIMIDINE

CAS: 944903-06-4

Purity: 97%

Molecular weight: 233.4499969

Ref: 10-F799654

3-Bromo-6-chloro-1H-pyrazolo[3,4-d]pyrimidine

CAS: 944903-06-4

Formula: C₅H₂BrClN₄

Purity: 95.0%

Molecular weight: 233.45

Ref: 10-F233285

3-Bromo-6-chloro-1H-pyrazolo[3,4-d]pyrimidine

Controlled Product

CAS: 944903-06-4

Applications Pyrazolo[3,4-d]pyrimidines have a close structural resemblance to the substrates for the enzyme xanthine oxidase, hypoxanthine (6-hydroxypurine) and xanthine (2,6-dihydroxypurine). These compounds are capable of binding to the enzyme and strongly inhibit its activity. They have been studied for their role in the treatment and prophylaxis of hyperuricemia in human patients as well as potential anti-tumor agents.
References Massey, V., et al.: J. Biol. Chem., 245, 2837 (1970), Escribano, J., et al.: Biochem. J., 254, 829 (1988_,,,,,13) Van Hoorn, D; Eur J Pharmacol 2002, 451, 111,,14) Tamta, H; J Enzyme Inhibition Med Chem 2005, 20, 317

Formula: C₅H₂BrClN₄

Color and Shape: Neat

Molecular weight: 233.45

Ref: TR-B682190