CAS 944903-11-1
:2-(4-Piperidinyl)-5-(trifluoromethyl)pyrimidine
Description:
2-(4-Piperidinyl)-5-(trifluoromethyl)pyrimidine is a chemical compound characterized by its pyrimidine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a piperidine group at the 2-position contributes to its basicity and potential for forming hydrogen bonds, while the trifluoromethyl group at the 5-position enhances its lipophilicity and may influence its biological activity. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its unique structural features may confer specific interactions with biological targets, making it a subject of interest in drug discovery. Additionally, the trifluoromethyl group is known to improve metabolic stability and bioavailability. As with many nitrogen-containing heterocycles, this compound may exhibit diverse reactivity and can be synthesized through various organic reactions, making it a versatile building block in synthetic chemistry.
Formula:C10H12F3N3
InChI:InChI=1S/C10H12F3N3/c11-10(12,13)8-5-15-9(16-6-8)7-1-3-14-4-2-7/h5-7,14H,1-4H2
InChI key:InChIKey=UADXUTYYMOWJFY-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=NC(=NC1)C2CCNCC2
Synonyms:- 2-(4-Piperidinyl)-5-(trifluoromethyl)pyrimidine
- Pyrimidine, 2-(4-piperidinyl)-5-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.