CAS 944903-19-9
:5-Chloro-N-methyl-2-pyrimidinemethanamine
Description:
5-Chloro-N-methyl-2-pyrimidinemethanamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chlorine atom at the 5-position of the pyrimidine ring contributes to its reactivity and potential biological activity. The N-methyl group indicates that a methyl group is attached to the nitrogen atom, influencing the compound's solubility and interaction with biological systems. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds. It is often studied for its potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. As with many nitrogen-containing heterocycles, it may also exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry.
Formula:C6H8ClN3
InChI:InChI=1S/C6H8ClN3/c1-8-4-6-9-2-5(7)3-10-6/h2-3,8H,4H2,1H3
InChI key:InChIKey=NVXLXHBGNKBBDW-UHFFFAOYSA-N
SMILES:C(NC)C=1N=CC(Cl)=CN1
Synonyms:- (5-Chloropyrimidin-2-yl)-N-methylmethanamine
- 5-Chloro-N-methyl-2-pyrimidinemethanamine
- 2-Pyrimidinemethanamine, 5-chloro-N-methyl-
- [(5-Chloropyrimidin-2-yl)methyl](methyl)amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-(5-Chloropyrimidin-2-yl)-N-methyl-d3-methanamine
CAS:Controlled ProductApplications 1-(5-Chloropyrimidin-2-yl)-N-methyl-d3-methanamine is the labeled analog of 1-(5-Chloropyrimidin-2-yl)-N-methylmethanamine (C374070), which is used in the preparation of pyrrolidine dervatives as β3-adrenoceptor agonists.
Formula:C6H5D3ClN3Color and Shape:NeatMolecular weight:353.4121-(5-Chloropyrimidin-2-yl)-N-methylmethanamine
CAS:Controlled ProductFormula:C6H8ClN3Color and Shape:NeatMolecular weight:432.94
