CAS 944903-20-2

2-(Aminomethyl)-7-benzoxazolecarbonitrile

Description:

2-(Aminomethyl)-7-benzoxazolecarbonitrile, with the CAS number 944903-20-2, is a chemical compound characterized by its unique structural features, which include a benzoxazole ring and a carbonitrile functional group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the amino and nitrile groups. The amino group can participate in hydrogen bonding, influencing its solubility and reactivity. The carbonitrile group contributes to its polarity and can serve as a site for further chemical modifications. Additionally, the benzoxazole moiety is known for its stability and can exhibit fluorescence, making this compound of interest in various fields, including pharmaceuticals and materials science. Its synthesis and characterization may involve standard organic chemistry techniques, and it may be evaluated for potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with any chemical substance, safety data and handling precautions should be consulted before use.

Formula: C₉H₇N₃O

InChI: InChI=1S/C9H7N3O/c10-4-6-2-1-3-7-9(6)13-8(5-11)12-7/h1-3H,5,11H2

InChI key: InChIKey=WKFHQJAIHQINDM-UHFFFAOYSA-N

SMILES: C(#N)C1=C2C(N=C(CN)O2)=CC=C1

Synonyms:

• 7-Benzoxazolecarbonitrile, 2-(aminomethyl)-
• 2-(Aminomethyl)-7-benzoxazolecarbonitrile