CymitQuimica logo

CAS 944903-61-1

:

4-(1,1-Dimethylethoxy)-2-pyrimidinemethanamine

Description:
4-(1,1-Dimethylethoxy)-2-pyrimidinemethanamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a 1,1-dimethylethoxy group, which contributes to its unique properties, including increased lipophilicity and potential for enhanced biological activity. The presence of the amine functional group indicates that it can participate in hydrogen bonding, influencing its solubility and reactivity. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by the steric effects of the dimethylethoxy group, which may affect its interaction with biological targets. Overall, 4-(1,1-Dimethylethoxy)-2-pyrimidinemethanamine represents a class of compounds that may exhibit interesting pharmacological properties, warranting further investigation in drug development and related fields.
Formula:C9H15N3O
InChI:InChI=1S/C9H15N3O/c1-9(2,3)13-8-4-5-11-7(6-10)12-8/h4-5H,6,10H2,1-3H3
InChI key:InChIKey=ARDUFXOEZAPMJL-UHFFFAOYSA-N
SMILES:O(C(C)(C)C)C1=NC(CN)=NC=C1
Synonyms:
  • 2-Pyrimidinemethanamine, 4-(1,1-dimethylethoxy)-
  • 4-(1,1-Dimethylethoxy)-2-pyrimidinemethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.