CAS 944904-29-4
:3-Iodo-5,6-dimethoxy-1H-indazole
Description:
3-Iodo-5,6-dimethoxy-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of iodine at the 3-position introduces notable reactivity and potential for further chemical transformations, while the dimethoxy groups at the 5 and 6 positions enhance its solubility and influence its electronic properties. This compound is typically used in research settings, particularly in medicinal chemistry, due to its potential biological activity. The methoxy groups can participate in various chemical reactions, making the compound versatile for synthetic applications. Additionally, the indazole framework is known for its presence in various pharmacologically active compounds, suggesting that derivatives of this structure may exhibit interesting pharmacological properties. As with many halogenated compounds, safety precautions should be observed due to the potential toxicity of iodine-containing substances. Overall, 3-Iodo-5,6-dimethoxy-1H-indazole represents a unique structure with implications in both synthetic and medicinal chemistry.
Formula:C9H9IN2O2
InChI:InChI=1S/C9H9IN2O2/c1-13-7-3-5-6(4-8(7)14-2)11-12-9(5)10/h3-4H,1-2H3,(H,11,12)
InChI key:InChIKey=GDKOKWILNDGZBR-UHFFFAOYSA-N
SMILES:IC=1C=2C(=CC(OC)=C(OC)C2)NN1
Synonyms:- 1H-Indazole, 3-iodo-5,6-dimethoxy-
- 3-Iodo-5,6-dimethoxy-1H-indazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
