CymitQuimica logo

CAS 944904-30-7

:

2,3-Dihydro-5-(trifluoromethoxy)-3-benzofuranamine

Description:
2,3-Dihydro-5-(trifluoromethoxy)-3-benzofuranamine is a chemical compound characterized by its unique structural features, which include a benzofuran core and a trifluoromethoxy substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the trifluoromethoxy group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The benzofuran moiety is known for its presence in various natural products and pharmaceuticals, often contributing to biological activity. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be utilized for its identification and characterization. Its CAS number, 944904-30-7, allows for precise referencing in chemical databases and literature. Overall, this compound's unique structure and substituents suggest potential applications in drug development and other chemical research areas.
Formula:C9H8F3NO2
InChI:InChI=1S/C9H8F3NO2/c10-9(11,12)15-5-1-2-8-6(3-5)7(13)4-14-8/h1-3,7H,4,13H2
InChI key:InChIKey=ZDVWVQNLYWQEOU-UHFFFAOYSA-N
SMILES:NC1C=2C(=CC=C(OC(F)(F)F)C2)OC1
Synonyms:
  • 3-Benzofuranamine, 2,3-dihydro-5-(trifluoromethoxy)-
  • 2,3-Dihydro-5-(trifluoromethoxy)-3-benzofuranamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.