
CAS 944904-50-1
:1-[2-Amino-6-(trifluoromethyl)-3-pyridinyl]ethanone
Description:
1-[2-Amino-6-(trifluoromethyl)-3-pyridinyl]ethanone, with the CAS number 944904-50-1, is a chemical compound characterized by its pyridine ring structure, which is substituted with an amino group and a trifluoromethyl group. This compound typically exhibits properties associated with both amines and ketones, including potential basicity due to the amino group and reactivity due to the carbonyl functionality. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The compound is likely to be a solid at room temperature and may have moderate solubility in polar solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Additionally, the trifluoromethyl group can impart unique electronic properties, which may affect the compound's interaction with biological targets. Overall, this compound represents a valuable scaffold for further exploration in chemical synthesis and drug development.
Formula:C8H7F3N2O
InChI:InChI=1S/C8H7F3N2O/c1-4(14)5-2-3-6(8(9,10)11)13-7(5)12/h2-3H,1H3,(H2,12,13)
InChI key:InChIKey=ZHPWFZDFWXGYJO-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N=C(N)C(C(C)=O)=CC1
Synonyms:- 1-[2-Amino-6-(trifluoromethyl)-3-pyridinyl]ethanone
- Ethanone, 1-[2-amino-6-(trifluoromethyl)-3-pyridinyl]-
- 1-[2-Amino-6-(trifluoromethyl)pyridin-3-yl]ethan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.