CAS 944904-71-6
:4-Cyclopropyl-2-pyrimidinemethanamine
Description:
4-Cyclopropyl-2-pyrimidinemethanamine is a chemical compound characterized by its unique structure, which includes a pyrimidine ring and a cyclopropyl group. This compound is classified as an amine due to the presence of an amine functional group (-NH2) attached to the pyrimidine moiety. The cyclopropyl group contributes to its three-membered ring structure, which can influence the compound's reactivity and steric properties. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The presence of the pyrimidine ring suggests potential interactions with biological targets, such as enzymes or receptors. Additionally, the specific arrangement of atoms can affect the compound's solubility, stability, and overall pharmacokinetic properties. As with many organic compounds, the synthesis and characterization of 4-Cyclopropyl-2-pyrimidinemethanamine would involve various analytical techniques to confirm its structure and purity. Overall, this compound represents a fascinating area of study within the field of organic and medicinal chemistry.
Formula:C8H11N3
InChI:InChI=1S/C8H11N3/c9-5-8-10-4-3-7(11-8)6-1-2-6/h3-4,6H,1-2,5,9H2
InChI key:InChIKey=XFOHQQWTJFRLEH-UHFFFAOYSA-N
SMILES:C(N)C=1N=C(C2CC2)C=CN1
Synonyms:- 2-Pyrimidinemethanamine, 4-cyclopropyl-
- 4-Cyclopropyl-2-pyrimidinemethanamine
- (4-Cyclopropylpyrimidin-2-yl)methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
