CAS 944904-74-9
:4-(1-Pyrrolidinyl)-2-pyrimidinemethanamine
Description:
4-(1-Pyrrolidinyl)-2-pyrimidinemethanamine, with the CAS number 944904-74-9, is a chemical compound characterized by its unique structure, which includes a pyrimidine ring and a pyrrolidine moiety. This compound typically exhibits properties associated with amines, such as basicity due to the presence of the amine functional group. It may also display moderate solubility in polar solvents, influenced by the nitrogen atoms in its structure. The presence of the pyrrolidine ring can contribute to its conformational flexibility, potentially affecting its biological activity and interactions. Compounds of this nature are often investigated for their pharmacological properties, particularly in the context of drug development, as they may act as ligands for various biological targets. Additionally, the specific arrangement of functional groups can lead to diverse reactivity patterns, making it a subject of interest in synthetic organic chemistry. Overall, 4-(1-Pyrrolidinyl)-2-pyrimidinemethanamine represents a class of compounds with potential applications in medicinal chemistry and related fields.
Formula:C9H14N4
InChI:InChI=1S/C9H14N4/c10-7-8-11-4-3-9(12-8)13-5-1-2-6-13/h3-4H,1-2,5-7,10H2
InChI key:InChIKey=YKNGOCJDSUJTHS-UHFFFAOYSA-N
SMILES:C(N)C=1N=C(C=CN1)N2CCCC2
Synonyms:- 2-Pyrimidinemethanamine, 4-(1-pyrrolidinyl)-
- 4-(1-Pyrrolidinyl)-2-pyrimidinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.