CAS 944905-09-3

3-Chloro-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine

Description:

3-Chloro-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both imidazole and pyrazine moieties. The presence of a chlorine atom at the 3-position contributes to its reactivity and potential biological activity. This compound is typically a colorless to pale yellow solid, exhibiting moderate solubility in polar organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of nitrogen atoms that can participate in hydrogen bonding and coordination with biological targets. The tetrahydro configuration indicates that the compound is saturated, which may influence its stability and reactivity compared to unsaturated analogs. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on the specific conditions and purity of the sample. Overall, 3-Chloro-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine represents a class of compounds of interest for further research and development in various chemical and biological applications.

Formula: C₆H₈ClN₃

InChI: InChI=1S/C6H8ClN3/c7-6-9-4-5-3-8-1-2-10(5)6/h4,8H,1-3H2

InChI key: InChIKey=HMININCDZZWTJU-UHFFFAOYSA-N

SMILES: ClC=1N2C(CNCC2)=CN1

Synonyms:

• Imidazo[1,5-a]pyrazine, 3-chloro-5,6,7,8-tetrahydro-
• 3-Chloro-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine