
CAS 944906-02-9
:3-Methyl-1,2,4-oxadiazole-5-carboxaldehyde
Description:
3-Methyl-1,2,4-oxadiazole-5-carboxaldehyde is a heterocyclic organic compound characterized by its oxadiazole ring, which contains nitrogen and oxygen atoms. This compound features a methyl group at the 3-position and an aldehyde functional group at the 5-position of the oxadiazole ring, contributing to its reactivity and potential applications in organic synthesis. The presence of the carboxaldehyde group makes it a versatile intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if ingested or inhaled. Overall, 3-Methyl-1,2,4-oxadiazole-5-carboxaldehyde is notable for its unique structural features and potential utility in chemical research and development.
Formula:C4H4N2O2
InChI:InChI=1S/C4H4N2O2/c1-3-5-4(2-7)8-6-3/h2H,1H3
InChI key:InChIKey=VGAOANULFATMLJ-UHFFFAOYSA-N
SMILES:C(=O)C1=NC(C)=NO1
Synonyms:- 3-Methyl-1,2,4-oxadiazole-5-carboxaldehyde
- 1,2,4-Oxadiazole-5-carboxaldehyde, 3-methyl-
- 3-Methyl-1,2,4-oxadiazole-5-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
