CymitQuimica logo

CAS 944906-18-7

:

2-(Chloromethyl)-4-(4-pyridinyl)pyrimidine

Description:
2-(Chloromethyl)-4-(4-pyridinyl)pyrimidine, with the CAS number 944906-18-7, is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms. This compound features a chloromethyl group (-CH2Cl) at the 2-position and a pyridinyl group at the 4-position, contributing to its unique reactivity and potential biological activity. The presence of the chloromethyl group makes it a suitable candidate for nucleophilic substitution reactions, while the pyridinyl moiety can enhance its solubility and interaction with biological targets. Typically, compounds of this nature are studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The molecular structure suggests that it may exhibit various properties, including moderate polarity and potential for hydrogen bonding, which can influence its behavior in biological systems. As with many heterocyclic compounds, the specific characteristics such as melting point, boiling point, and solubility would depend on the purity and specific conditions under which the compound is analyzed.
Formula:C10H8ClN3
InChI:InChI=1S/C10H8ClN3/c11-7-10-13-6-3-9(14-10)8-1-4-12-5-2-8/h1-6H,7H2
InChI key:InChIKey=CJDJYXFQTPGZRK-UHFFFAOYSA-N
SMILES:C(Cl)C=1N=C(C=CN1)C=2C=CN=CC2
Synonyms:
  • 2-(Chloromethyl)-4-(4-pyridinyl)pyrimidine
  • Pyrimidine, 2-(chloromethyl)-4-(4-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.