CAS 944906-74-5

4-Bromo-2-oxazolecarboxylic acid

Description:

4-Bromo-2-oxazolecarboxylic acid is a heterocyclic organic compound characterized by the presence of a bromine atom and an oxazole ring, which is a five-membered aromatic ring containing both nitrogen and oxygen. This compound typically exhibits properties such as moderate solubility in polar solvents due to the carboxylic acid functional group, which can engage in hydrogen bonding. The bromine substituent can influence the compound's reactivity, making it useful in various synthetic applications, including medicinal chemistry and material science. The oxazole moiety contributes to the compound's potential biological activity, as oxazole derivatives are often explored for their pharmacological properties. Additionally, the presence of the carboxylic acid group allows for further functionalization, making it a versatile intermediate in organic synthesis. Overall, 4-Bromo-2-oxazolecarboxylic acid is notable for its unique structural features and potential applications in research and industry.

Formula: C₄H₂BrNO₃

InChI: InChI=1S/C4H2BrNO3/c5-2-1-9-3(6-2)4(7)8/h1H,(H,7,8)

InChI key: InChIKey=RLDKHSPSCDLNRZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=NC(Br)=CO1

Synonyms:

• 4-Bromo-2-oxazolecarboxylic acid
• 2-Oxazolecarboxylic acid, 4-bromo-
• 4-Bromooxazole-2-carboxylic acid

4-Bromo-oxazole-2-carboxylic acid

CAS: 944906-74-5

Versatile small molecule scaffold

Formula: C₄H₂BrNO₃

Purity: Min. 95%

Molecular weight: 191.97 g/mol

Ref: 3D-UMB90674