
CAS 944906-78-9
:5-(1,1-Dimethylethyl)-1,3,4-oxadiazole-2-methanamine
Description:
5-(1,1-Dimethylethyl)-1,3,4-oxadiazole-2-methanamine is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. The presence of the 1,1-dimethylethyl group contributes to its steric bulk, potentially influencing its reactivity and interactions with other molecules. This compound features an amine functional group, which can participate in hydrogen bonding and nucleophilic reactions, making it relevant in various chemical applications, including pharmaceuticals and agrochemicals. The oxadiazole moiety is known for its biological activity, and compounds containing this structure may exhibit antimicrobial, antifungal, or anti-inflammatory properties. The specific properties, such as solubility, melting point, and stability, would depend on the molecular environment and substituents. Overall, 5-(1,1-Dimethylethyl)-1,3,4-oxadiazole-2-methanamine is a compound of interest in synthetic chemistry and medicinal research due to its unique structural features and potential biological activities.
Formula:C7H13N3O
InChI:InChI=1S/C7H13N3O/c1-7(2,3)6-10-9-5(4-8)11-6/h4,8H2,1-3H3
InChI key:InChIKey=UCPGZQLXAUPIMA-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C=1OC(CN)=NN1
Synonyms:- 1,3,4-Oxadiazole-2-methanamine, 5-(1,1-dimethylethyl)-
- 5-(1,1-Dimethylethyl)-1,3,4-oxadiazole-2-methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.